About N,N'-dihydroxyocta-2,6-dienediamide
N,N'-dihydroxyocta-2,6-dienediamide (PubChem CID 53435565) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is N,N'-dihydroxyocta-2,6-dienediamide.
Molecular Properties
| Compound Name | N,N'-dihydroxyocta-2,6-dienediamide |
| PubChem CID | 53435565 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | N,N'-dihydroxyocta-2,6-dienediamide |
| SMILES | O=C(C=CCCC=CC(=O)NO)NO |
| InChI | InChI=1S/C8H12N2O4/c11-7(9-13)5-3-1-2-4-6-8(12)10-14/h3-6,13-14H,1-2H2,(H,9,11)(H,10,12) |
| InChIKey | WAUMXMQJIMQTJK-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N'-dihydroxyocta-2,6-dienediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N'-dihydroxyocta-2,6-dienediamide?
The IUPAC name of N,N'-dihydroxyocta-2,6-dienediamide (CID 53435565) is N,N'-dihydroxyocta-2,6-dienediamide.
What is the SMILES notation for N,N'-dihydroxyocta-2,6-dienediamide?
The canonical SMILES for N,N'-dihydroxyocta-2,6-dienediamide is O=C(C=CCCC=CC(=O)NO)NO.
What is the InChIKey of N,N'-dihydroxyocta-2,6-dienediamide?
The InChIKey is WAUMXMQJIMQTJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c11-7(9-13)5-3-1-2-4-6-8(12)10-14/h3-6,13-14H,1-2H2,(H,9,11)(H,10,12).
What are the key properties of N,N'-dihydroxyocta-2,6-dienediamide?
N,N'-dihydroxyocta-2,6-dienediamide has a molecular weight of 200.19 g/mol, XLogP of -0.11, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N'-dihydroxyocta-2,6-dienediamide is sourced from PubChem (CID 53435565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).