C15H18O3 — CID 534358
3,3,5,5-tetramethyl-6-phenyloxane-2,4-dione (PubChem CID 534358) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-6-phenyloxane-2,4-dione.
| Compound Name | 3,3,5,5-tetramethyl-6-phenyloxane-2,4-dione |
|---|---|
| PubChem CID | 534358 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 3,3,5,5-tetramethyl-6-phenyloxane-2,4-dione |
| SMILES | CC1(C)C(=O)OC(c2ccccc2)C(C)(C)C1=O |
| InChI | InChI=1S/C15H18O3/c1-14(2)11(10-8-6-5-7-9-10)18-13(17)15(3,4)12(14)16/h5-9,11H,1-4H3 |
| InChIKey | ZQVPXIQBPCOQJJ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|