About 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one
6-hydroxy-5-methyl-6,8-dihydropteridin-7-one (PubChem CID 53435949) has the molecular formula C7H8N4O2
and a molecular weight of 180.17 g/mol. Its IUPAC name is 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one.
Molecular Properties
| Compound Name | 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one |
| PubChem CID | 53435949 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one |
| SMILES | CN1c2cncnc2NC(=O)C1O |
| InChI | InChI=1S/C7H8N4O2/c1-11-4-2-8-3-9-5(4)10-6(12)7(11)13/h2-3,7,13H,1H3,(H,8,9,10,12) |
| InChIKey | HGMICOAUKQSYPC-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one?
The IUPAC name of 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one (CID 53435949) is 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one.
What is the SMILES notation for 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one?
The canonical SMILES for 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one is CN1c2cncnc2NC(=O)C1O.
What is the InChIKey of 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one?
The InChIKey is HGMICOAUKQSYPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O2/c1-11-4-2-8-3-9-5(4)10-6(12)7(11)13/h2-3,7,13H,1H3,(H,8,9,10,12).
What are the key properties of 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one?
6-hydroxy-5-methyl-6,8-dihydropteridin-7-one has a molecular weight of 180.17 g/mol, XLogP of -0.82, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxy-5-methyl-6,8-dihydropteridin-7-one is sourced from PubChem (CID 53435949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).