About cyclohex-4-ene-1,2,3-triimine
cyclohex-4-ene-1,2,3-triimine (PubChem CID 53436011) has the molecular formula C6H7N3
and a molecular weight of 121.14 g/mol. Its IUPAC name is cyclohex-4-ene-1,2,3-triimine.
Molecular Properties
| Compound Name | cyclohex-4-ene-1,2,3-triimine |
| PubChem CID | 53436011 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | cyclohex-4-ene-1,2,3-triimine |
| SMILES | [H]/N=C1\C=CCC(=N\[H])/C1=N\[H] |
| InChI | InChI=1S/C6H7N3/c7-4-2-1-3-5(8)6(4)9/h1-2,7-9H,3H2/b7-4+,8-5+,9-6- |
| InChIKey | JVCFGFWEEDAATR-QGEWSIJFSA-N |
| XLogP | 1.01 |
| TPSA | 71.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze cyclohex-4-ene-1,2,3-triimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohex-4-ene-1,2,3-triimine?
The IUPAC name of cyclohex-4-ene-1,2,3-triimine (CID 53436011) is cyclohex-4-ene-1,2,3-triimine.
What is the SMILES notation for cyclohex-4-ene-1,2,3-triimine?
The canonical SMILES for cyclohex-4-ene-1,2,3-triimine is [H]/N=C1\C=CCC(=N\[H])/C1=N\[H].
What is the InChIKey of cyclohex-4-ene-1,2,3-triimine?
The InChIKey is JVCFGFWEEDAATR-QGEWSIJFSA-N. The full InChI is InChI=1S/C6H7N3/c7-4-2-1-3-5(8)6(4)9/h1-2,7-9H,3H2/b7-4+,8-5+,9-6-.
What are the key properties of cyclohex-4-ene-1,2,3-triimine?
cyclohex-4-ene-1,2,3-triimine has a molecular weight of 121.14 g/mol, XLogP of 1.01, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohex-4-ene-1,2,3-triimine is sourced from PubChem (CID 53436011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).