About 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine
3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine (PubChem CID 53436131) has the molecular formula C26H35N3O3
and a molecular weight of 437.58 g/mol. Its IUPAC name is 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine.
Molecular Properties
| Compound Name | 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine |
| PubChem CID | 53436131 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine |
| SMILES | CCCCCCOc1c(O)ccc(CC)c1CC.COc1cnnnc1-c1ccccc1 |
| InChI | InChI=1S/C16H26O2.C10H9N3O/c1-4-7-8-9-12-18-16-14(6-3)13(5-2)10-11-15(16)17;1-14-9-7-11-13-12-10(9)8-5-3-2-4-6-8/h10-11,17H,4-9,12H2,1-3H3;2-7H,1H3 |
| InChIKey | ZDHRAACDPXUCHC-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine?
The IUPAC name of 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine (CID 53436131) is 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine.
What is the SMILES notation for 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine?
The canonical SMILES for 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine is CCCCCCOc1c(O)ccc(CC)c1CC.COc1cnnnc1-c1ccccc1.
What is the InChIKey of 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine?
The InChIKey is ZDHRAACDPXUCHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26O2.C10H9N3O/c1-4-7-8-9-12-18-16-14(6-3)13(5-2)10-11-15(16)17;1-14-9-7-11-13-12-10(9)8-5-3-2-4-6-8/h10-11,17H,4-9,12H2,1-3H3;2-7H,1H3.
What are the key properties of 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine?
3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine has a molecular weight of 437.58 g/mol, XLogP of 6.02, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-diethyl-2-hexoxyphenol;5-methoxy-4-phenyltriazine is sourced from PubChem (CID 53436131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).