C21H19Cl2N2O5S- — CID 53436215
2-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl]-4-methylbenzenesulfonate (PubChem CID 53436215) has the molecular formula C21H19Cl2N2O5S- and a molecular weight of 482.37 g/mol. Its IUPAC name is 2-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl]-4-methylbenzenesulfonate.
| Compound Name | 2-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl]-4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 53436215 |
| Molecular Formula | C21H19Cl2N2O5S- |
| Molecular Weight | 482.37 g/mol |
| Exact Mass | 481.04 |
| IUPAC Name | 2-[[2-(2,4-dichlorophenyl)-2-(imidazol-1-ylmethyl)-1,3-dioxolan-4-yl]methyl]-4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)[O-])c(CC2COC(Cn3ccnc3)(c3ccc(Cl)cc3Cl)O2)c1 |
| InChI | InChI=1S/C21H20Cl2N2O5S/c1-14-2-5-20(31(26,27)28)15(8-14)9-17-11-29-21(30-17,12-25-7-6-24-13-25)18-4-3-16(22)10-19(18)23/h2-8,10,13,17H,9,11-12H2,1H3,(H,26,27,28)/p-1 |
| InChIKey | FJIGMSPUNVJDKV-UHFFFAOYSA-M |
| XLogP | 3.91 |
| TPSA | 93.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|