About 2,6-dimethylheptanoate
2,6-dimethylheptanoate (PubChem CID 53436705) has the molecular formula C9H17O2-
and a molecular weight of 157.23 g/mol. Its IUPAC name is 2,6-dimethylheptanoate.
Molecular Properties
| Compound Name | 2,6-dimethylheptanoate |
| PubChem CID | 53436705 |
| Molecular Formula | C9H17O2- |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 2,6-dimethylheptanoate |
| SMILES | CC(C)CCCC(C)C(=O)[O-] |
| InChI | InChI=1S/C9H18O2/c1-7(2)5-4-6-8(3)9(10)11/h7-8H,4-6H2,1-3H3,(H,10,11)/p-1 |
| InChIKey | MDAPKSVKYITQHQ-UHFFFAOYSA-M |
| XLogP | 1.20 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,6-dimethylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylheptanoate?
The IUPAC name of 2,6-dimethylheptanoate (CID 53436705) is 2,6-dimethylheptanoate.
What is the SMILES notation for 2,6-dimethylheptanoate?
The canonical SMILES for 2,6-dimethylheptanoate is CC(C)CCCC(C)C(=O)[O-].
What is the InChIKey of 2,6-dimethylheptanoate?
The InChIKey is MDAPKSVKYITQHQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O2/c1-7(2)5-4-6-8(3)9(10)11/h7-8H,4-6H2,1-3H3,(H,10,11)/p-1.
What are the key properties of 2,6-dimethylheptanoate?
2,6-dimethylheptanoate has a molecular weight of 157.23 g/mol, XLogP of 1.20, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylheptanoate is sourced from PubChem (CID 53436705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).