C6H4Cl3F9Si — CID 53437827
trichloro(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane (PubChem CID 53437827) has the molecular formula C6H4Cl3F9Si and a molecular weight of 381.53 g/mol. Its IUPAC name is trichloro(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane.
| Compound Name | trichloro(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 53437827 |
| Molecular Formula | C6H4Cl3F9Si |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | trichloro(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane |
| SMILES | FC(F)(F)CCC(F)(F)C(F)(F)C(F)(F)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H4Cl3F9Si/c7-19(8,9)6(17,18)5(15,16)3(10,11)1-2-4(12,13)14/h1-2H2 |
| InChIKey | ANCJPQMZAFESOZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|