C12H19F9O3Si — CID 53437828
triethoxy(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane (PubChem CID 53437828) has the molecular formula C12H19F9O3Si and a molecular weight of 410.35 g/mol. Its IUPAC name is triethoxy(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane.
| Compound Name | triethoxy(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 53437828 |
| Molecular Formula | C12H19F9O3Si |
| Molecular Weight | 410.35 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | triethoxy(1,1,2,2,3,3,6,6,6-nonafluorohexyl)silane |
| SMILES | CCO[Si](OCC)(OCC)C(F)(F)C(F)(F)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C12H19F9O3Si/c1-4-22-25(23-5-2,24-6-3)12(20,21)11(18,19)9(13,14)7-8-10(15,16)17/h4-8H2,1-3H3 |
| InChIKey | AZOLQBGEMLPHAI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.35 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|