About Tri(butyl)vinyltin
Tri(butyl)vinyltin (PubChem CID 53438229) has the molecular formula C14H27Sn
and a molecular weight of 314.08 g/mol.
Molecular Properties
| Compound Name | Tri(butyl)vinyltin |
| PubChem CID | 53438229 |
| Molecular Formula | C14H27Sn |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | — |
| SMILES | CCCCC([Sn])=C(CCCC)CCCC |
| InChI | InChI=1S/C14H27.Sn/c1-4-7-10-13-14(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3; |
| InChIKey | SHPQVJNNBXMZRW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze Tri(butyl)vinyltin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Tri(butyl)vinyltin?
The IUPAC name of Tri(butyl)vinyltin (CID 53438229) is not available.
What is the SMILES notation for Tri(butyl)vinyltin?
The canonical SMILES for Tri(butyl)vinyltin is CCCCC([Sn])=C(CCCC)CCCC.
What is the InChIKey of Tri(butyl)vinyltin?
The InChIKey is SHPQVJNNBXMZRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H27.Sn/c1-4-7-10-13-14(11-8-5-2)12-9-6-3;/h4-12H2,1-3H3;.
What are the key properties of Tri(butyl)vinyltin?
Tri(butyl)vinyltin has a molecular weight of 314.08 g/mol, XLogP of 4.98, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for Tri(butyl)vinyltin is sourced from PubChem (CID 53438229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).