About 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride
6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride (PubChem CID 53438321) has the molecular formula C6H10Cl2N4
and a molecular weight of 209.08 g/mol. Its IUPAC name is 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride.
Molecular Properties
| Compound Name | 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride |
| PubChem CID | 53438321 |
| Molecular Formula | C6H10Cl2N4 |
| Molecular Weight | 209.08 g/mol |
| Exact Mass | 208.03 |
| IUPAC Name | 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1ncc2c(n1)CNC2 |
| InChI | InChI=1S/C6H8N4.2ClH/c7-6-9-2-4-1-8-3-5(4)10-6;;/h2,8H,1,3H2,(H2,7,9,10);2*1H |
| InChIKey | IDVFIDIYCKHAEX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.08 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride?
The IUPAC name of 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride (CID 53438321) is 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride.
What is the SMILES notation for 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride?
The canonical SMILES for 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride is Cl.Cl.Nc1ncc2c(n1)CNC2.
What is the InChIKey of 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride?
The InChIKey is IDVFIDIYCKHAEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N4.2ClH/c7-6-9-2-4-1-8-3-5(4)10-6;;/h2,8H,1,3H2,(H2,7,9,10);2*1H.
What are the key properties of 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride?
6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride has a molecular weight of 209.08 g/mol, XLogP of 0.51, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidin-2-amine;dihydrochloride is sourced from PubChem (CID 53438321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).