About 5,6-dichloro-1H-imidazo[4,5-b]pyridine
5,6-dichloro-1H-imidazo[4,5-b]pyridine (PubChem CID 53438932) has the molecular formula C6H3Cl2N3
and a molecular weight of 188.02 g/mol. Its IUPAC name is 5,6-dichloro-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 5,6-dichloro-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 53438932 |
| Molecular Formula | C6H3Cl2N3 |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 186.97 |
| IUPAC Name | 5,6-dichloro-1H-imidazo[4,5-b]pyridine |
| SMILES | Clc1cc2[nH]cnc2nc1Cl |
| InChI | InChI=1S/C6H3Cl2N3/c7-3-1-4-6(10-2-9-4)11-5(3)8/h1-2H,(H,9,10,11) |
| InChIKey | UWYSZYFNTMSWDF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dichloro-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dichloro-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 5,6-dichloro-1H-imidazo[4,5-b]pyridine (CID 53438932) is 5,6-dichloro-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 5,6-dichloro-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 5,6-dichloro-1H-imidazo[4,5-b]pyridine is Clc1cc2[nH]cnc2nc1Cl.
What is the InChIKey of 5,6-dichloro-1H-imidazo[4,5-b]pyridine?
The InChIKey is UWYSZYFNTMSWDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3Cl2N3/c7-3-1-4-6(10-2-9-4)11-5(3)8/h1-2H,(H,9,10,11).
What are the key properties of 5,6-dichloro-1H-imidazo[4,5-b]pyridine?
5,6-dichloro-1H-imidazo[4,5-b]pyridine has a molecular weight of 188.02 g/mol, XLogP of 2.26, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dichloro-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 53438932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).