5-chloro-1,3-thiazole-2-carboxylic acid

C4H2ClNO2S — CID 53438974

IUPAC5-chloro-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1ncc(Cl)s1
InChIInChI=1S/C4H2ClNO2S/c5-2-1-6-3(9-2)4(7)8/h1H,(H,7,8)
InChIKeyJZFTYFVKMBSMFP-UHFFFAOYSA-N
MW163.59 g/mol
LogP1.49
Rot. Bonds1

About 5-chloro-1,3-thiazole-2-carboxylic acid

5-chloro-1,3-thiazole-2-carboxylic acid (PubChem CID 53438974) has the molecular formula C4H2ClNO2S and a molecular weight of 163.59 g/mol. Its IUPAC name is 5-chloro-1,3-thiazole-2-carboxylic acid.

Molecular Properties

Compound Name5-chloro-1,3-thiazole-2-carboxylic acid
PubChem CID53438974
Molecular FormulaC4H2ClNO2S
Molecular Weight163.59 g/mol
Exact Mass162.95
IUPAC Name5-chloro-1,3-thiazole-2-carboxylic acid
SMILESO=C(O)c1ncc(Cl)s1
InChIInChI=1S/C4H2ClNO2S/c5-2-1-6-3(9-2)4(7)8/h1H,(H,7,8)
InChIKeyJZFTYFVKMBSMFP-UHFFFAOYSA-N
XLogP1.49
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500163.59
LogP ≤ 51.49
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-chloro-1,3-thiazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-1,3-thiazole-2-carboxylic acid?
The IUPAC name of 5-chloro-1,3-thiazole-2-carboxylic acid (CID 53438974) is 5-chloro-1,3-thiazole-2-carboxylic acid.
What is the SMILES notation for 5-chloro-1,3-thiazole-2-carboxylic acid?
The canonical SMILES for 5-chloro-1,3-thiazole-2-carboxylic acid is O=C(O)c1ncc(Cl)s1.
What is the InChIKey of 5-chloro-1,3-thiazole-2-carboxylic acid?
The InChIKey is JZFTYFVKMBSMFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2ClNO2S/c5-2-1-6-3(9-2)4(7)8/h1H,(H,7,8).
What are the key properties of 5-chloro-1,3-thiazole-2-carboxylic acid?
5-chloro-1,3-thiazole-2-carboxylic acid has a molecular weight of 163.59 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,3-thiazole-2-carboxylic acid is sourced from PubChem (CID 53438974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).