About 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol
5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol (PubChem CID 53439054) has the molecular formula C10H13NO
and a molecular weight of 163.22 g/mol. Its IUPAC name is 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol.
Molecular Properties
| Compound Name | 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol |
| PubChem CID | 53439054 |
| Molecular Formula | C10H13NO |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.10 |
| IUPAC Name | 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol |
| SMILES | NCc1ccc2c(c1)CCC2O |
| InChI | InChI=1S/C10H13NO/c11-6-7-1-3-9-8(5-7)2-4-10(9)12/h1,3,5,10,12H,2,4,6,11H2 |
| InChIKey | MUUWCBRAVNOUBY-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol?
The IUPAC name of 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol (CID 53439054) is 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol.
What is the SMILES notation for 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol?
The canonical SMILES for 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol is NCc1ccc2c(c1)CCC2O.
What is the InChIKey of 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol?
The InChIKey is MUUWCBRAVNOUBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO/c11-6-7-1-3-9-8(5-7)2-4-10(9)12/h1,3,5,10,12H,2,4,6,11H2.
What are the key properties of 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol?
5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol has a molecular weight of 163.22 g/mol, XLogP of 1.12, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(aminomethyl)-2,3-dihydro-1H-inden-1-ol is sourced from PubChem (CID 53439054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).