C12H13N5O5 — CID 53439503
6,7-Dimethoxy-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid--triaza-1,2-dien-2-ium-1-ide (1/1) (PubChem CID 53439503) has the molecular formula C12H13N5O5 and a molecular weight of 307.27 g/mol.
| Compound Name | 6,7-Dimethoxy-4-methyl-3-oxo-3,4-dihydroquinoxaline-2-carboxylic acid--triaza-1,2-dien-2-ium-1-ide (1/1) |
|---|---|
| PubChem CID | 53439503 |
| Molecular Formula | C12H13N5O5 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | — |
| SMILES | COc1cc2nc(C(=O)O)c(=O)n(C)c2cc1OC.[N-]=[N+]=N |
| InChI | InChI=1S/C12H12N2O5.HN3/c1-14-7-5-9(19-3)8(18-2)4-6(7)13-10(11(14)15)12(16)17;1-3-2/h4-5H,1-3H3,(H,16,17);1H |
| InChIKey | FTDNLNJPLAUHCD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|