C16H22N2O3 — CID 5344000
ethyl (5E)-5-hydroxyimino-2,4,7,7-tetramethyl-6,8-dihydroquinoline-3-carboxylate (PubChem CID 5344000) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is ethyl (5E)-5-hydroxyimino-2,4,7,7-tetramethyl-6,8-dihydroquinoline-3-carboxylate.
| Compound Name | ethyl (5E)-5-hydroxyimino-2,4,7,7-tetramethyl-6,8-dihydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 5344000 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | ethyl (5E)-5-hydroxyimino-2,4,7,7-tetramethyl-6,8-dihydroquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1c(C)nc2c(c1C)/C(=N/O)CC(C)(C)C2 |
| InChI | InChI=1S/C16H22N2O3/c1-6-21-15(19)13-9(2)14-11(17-10(13)3)7-16(4,5)8-12(14)18-20/h20H,6-8H2,1-5H3/b18-12+ |
| InChIKey | QZADYVKCOXLBRV-LDADJPATSA-N |
| XLogP | 3.03 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|