C18H27F5Sn — CID 53440191
dibutyl-(1,1,4,4,4-pentafluorobutyl)-phenylstannane (PubChem CID 53440191) has the molecular formula C18H27F5Sn and a molecular weight of 457.12 g/mol. Its IUPAC name is dibutyl-(1,1,4,4,4-pentafluorobutyl)-phenylstannane.
| Compound Name | dibutyl-(1,1,4,4,4-pentafluorobutyl)-phenylstannane |
|---|---|
| PubChem CID | 53440191 |
| Molecular Formula | C18H27F5Sn |
| Molecular Weight | 457.12 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | dibutyl-(1,1,4,4,4-pentafluorobutyl)-phenylstannane |
| SMILES | CCCC[Sn](CCCC)(c1ccccc1)C(F)(F)CCC(F)(F)F |
| InChI | InChI=1S/C6H5.C4H4F5.2C4H9.Sn/c1-2-4-6-5-3-1;5-3(6)1-2-4(7,8)9;2*1-3-4-2;/h1-5H;1-2H2;2*1,3-4H2,2H3; |
| InChIKey | PKMFSZCDJPXNAP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.12 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |