C2H4F4N4O2 — CID 53440224
1-N',1-N',2-N,2-N-tetrafluoro-2-nitroethane-1,1,2-triamine (PubChem CID 53440224) has the molecular formula C2H4F4N4O2 and a molecular weight of 192.07 g/mol. Its IUPAC name is 1-N',1-N',2-N,2-N-tetrafluoro-2-nitroethane-1,1,2-triamine.
| Compound Name | 1-N',1-N',2-N,2-N-tetrafluoro-2-nitroethane-1,1,2-triamine |
|---|---|
| PubChem CID | 53440224 |
| Molecular Formula | C2H4F4N4O2 |
| Molecular Weight | 192.07 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | 1-N',1-N',2-N,2-N-tetrafluoro-2-nitroethane-1,1,2-triamine |
| SMILES | NC(C(N(F)F)[N+](=O)[O-])N(F)F |
| InChI | InChI=1S/C2H4F4N4O2/c3-8(4)1(7)2(9(5)6)10(11)12/h1-2H,7H2 |
| InChIKey | AVLZPAXYANRXOB-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 75.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.07 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|