C26H43NO — CID 53440371
1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)azepan-2-one (PubChem CID 53440371) has the molecular formula C26H43NO and a molecular weight of 385.64 g/mol. Its IUPAC name is 1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)azepan-2-one.
| Compound Name | 1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)azepan-2-one |
|---|---|
| PubChem CID | 53440371 |
| Molecular Formula | C26H43NO |
| Molecular Weight | 385.64 g/mol |
| Exact Mass | 385.33 |
| IUPAC Name | 1-(3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraenyl)azepan-2-one |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCN1CCCCCC1=O |
| InChI | InChI=1S/C26H43NO/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-17-25(5)19-21-27-20-8-6-7-18-26(27)28/h12,14,16,19H,6-11,13,15,17-18,20-21H2,1-5H3 |
| InChIKey | CEMMKPPUZSMGFQ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.64 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|