About 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline
2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline (PubChem CID 53440434) has the molecular formula C16H23N
and a molecular weight of 229.37 g/mol. Its IUPAC name is 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline.
Molecular Properties
| Compound Name | 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline |
| PubChem CID | 53440434 |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.18 |
| IUPAC Name | 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline |
| SMILES | CC(C)=CCc1ccc2c(c1)CCC(C)(C)N2 |
| InChI | InChI=1S/C16H23N/c1-12(2)5-6-13-7-8-15-14(11-13)9-10-16(3,4)17-15/h5,7-8,11,17H,6,9-10H2,1-4H3 |
| InChIKey | YBAZSIPPTWTTTJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline?
The IUPAC name of 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline (CID 53440434) is 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline.
What is the SMILES notation for 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline?
The canonical SMILES for 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline is CC(C)=CCc1ccc2c(c1)CCC(C)(C)N2.
What is the InChIKey of 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline?
The InChIKey is YBAZSIPPTWTTTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23N/c1-12(2)5-6-13-7-8-15-14(11-13)9-10-16(3,4)17-15/h5,7-8,11,17H,6,9-10H2,1-4H3.
What are the key properties of 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline?
2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline has a molecular weight of 229.37 g/mol, XLogP of 4.33, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-6-(3-methylbut-2-enyl)-3,4-dihydro-1H-quinoline is sourced from PubChem (CID 53440434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).