About 1,4-dioxaspiro[4.4]nona-6,8-diene
1,4-dioxaspiro[4.4]nona-6,8-diene (PubChem CID 53440512) has the molecular formula C7H8O2
and a molecular weight of 124.14 g/mol. Its IUPAC name is 1,4-dioxaspiro[4.4]nona-6,8-diene.
Molecular Properties
| Compound Name | 1,4-dioxaspiro[4.4]nona-6,8-diene |
| PubChem CID | 53440512 |
| Molecular Formula | C7H8O2 |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.05 |
| IUPAC Name | 1,4-dioxaspiro[4.4]nona-6,8-diene |
| SMILES | C1=CC2(C=C1)OCCO2 |
| InChI | InChI=1S/C7H8O2/c1-2-4-7(3-1)8-5-6-9-7/h1-4H,5-6H2 |
| InChIKey | UALBYISAMVUACM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,4-dioxaspiro[4.4]nona-6,8-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dioxaspiro[4.4]nona-6,8-diene?
The IUPAC name of 1,4-dioxaspiro[4.4]nona-6,8-diene (CID 53440512) is 1,4-dioxaspiro[4.4]nona-6,8-diene.
What is the SMILES notation for 1,4-dioxaspiro[4.4]nona-6,8-diene?
The canonical SMILES for 1,4-dioxaspiro[4.4]nona-6,8-diene is C1=CC2(C=C1)OCCO2.
What is the InChIKey of 1,4-dioxaspiro[4.4]nona-6,8-diene?
The InChIKey is UALBYISAMVUACM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2/c1-2-4-7(3-1)8-5-6-9-7/h1-4H,5-6H2.
What are the key properties of 1,4-dioxaspiro[4.4]nona-6,8-diene?
1,4-dioxaspiro[4.4]nona-6,8-diene has a molecular weight of 124.14 g/mol, XLogP of 0.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxaspiro[4.4]nona-6,8-diene is sourced from PubChem (CID 53440512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).