About N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride
N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride (PubChem CID 53441010) has the molecular formula C7H8Cl3NO
and a molecular weight of 228.51 g/mol. Its IUPAC name is N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride.
Molecular Properties
| Compound Name | N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| PubChem CID | 53441010 |
| Molecular Formula | C7H8Cl3NO |
| Molecular Weight | 228.51 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride |
| SMILES | Cl.ONCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C7H7Cl2NO.ClH/c8-6-2-1-5(4-10-11)7(9)3-6;/h1-3,10-11H,4H2;1H |
| InChIKey | RYKQXFMRIUYEHT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride?
The IUPAC name of N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride (CID 53441010) is N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride.
What is the SMILES notation for N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride?
The canonical SMILES for N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride is Cl.ONCc1ccc(Cl)cc1Cl.
What is the InChIKey of N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride?
The InChIKey is RYKQXFMRIUYEHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2NO.ClH/c8-6-2-1-5(4-10-11)7(9)3-6;/h1-3,10-11H,4H2;1H.
What are the key properties of N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride?
N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride has a molecular weight of 228.51 g/mol, XLogP of 2.89, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2,4-dichlorophenyl)methyl]hydroxylamine;hydrochloride is sourced from PubChem (CID 53441010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).