C22H21NO6S2 — CID 5344108
2-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid (PubChem CID 5344108) has the molecular formula C22H21NO6S2 and a molecular weight of 459.55 g/mol. Its IUPAC name is 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 5344108 |
| Molecular Formula | C22H21NO6S2 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | 2-[(5Z)-4-oxo-2-sulfanylidene-5-[(3,4,5-trimethoxyphenyl)methylidene]-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(C(Cc3ccccc3)C(=O)O)C2=O)cc(OC)c1OC |
| InChI | InChI=1S/C22H21NO6S2/c1-27-16-10-14(11-17(28-2)19(16)29-3)12-18-20(24)23(22(30)31-18)15(21(25)26)9-13-7-5-4-6-8-13/h4-8,10-12,15H,9H2,1-3H3,(H,25,26)/b18-12- |
| InChIKey | JQXGOHPBBOMBJR-PDGQHHTCSA-N |
| XLogP | 3.61 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|