C14H20F3NO4 — CID 53441476
1-O-tert-butyl 7-O-methyl 7-(trifluoromethyl)-5,6-dihydro-2H-azepine-1,7-dicarboxylate (PubChem CID 53441476) has the molecular formula C14H20F3NO4 and a molecular weight of 323.31 g/mol. Its IUPAC name is 1-O-tert-butyl 7-O-methyl 7-(trifluoromethyl)-5,6-dihydro-2H-azepine-1,7-dicarboxylate.
| Compound Name | 1-O-tert-butyl 7-O-methyl 7-(trifluoromethyl)-5,6-dihydro-2H-azepine-1,7-dicarboxylate |
|---|---|
| PubChem CID | 53441476 |
| Molecular Formula | C14H20F3NO4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-O-tert-butyl 7-O-methyl 7-(trifluoromethyl)-5,6-dihydro-2H-azepine-1,7-dicarboxylate |
| SMILES | COC(=O)C1(C(F)(F)F)CCC=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H20F3NO4/c1-12(2,3)22-11(20)18-9-7-5-6-8-13(18,10(19)21-4)14(15,16)17/h5,7H,6,8-9H2,1-4H3 |
| InChIKey | OVBJNYZJNRPDJM-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|