C17H24BClO4 — CID 53441627
2-[4-[2-(3-chloropropyl)-1,3-dioxolan-2-yl]phenyl]-5,5-dimethyl-1,3,2-dioxaborinane (PubChem CID 53441627) has the molecular formula C17H24BClO4 and a molecular weight of 338.64 g/mol. Its IUPAC name is 2-[4-[2-(3-chloropropyl)-1,3-dioxolan-2-yl]phenyl]-5,5-dimethyl-1,3,2-dioxaborinane.
| Compound Name | 2-[4-[2-(3-chloropropyl)-1,3-dioxolan-2-yl]phenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 53441627 |
| Molecular Formula | C17H24BClO4 |
| Molecular Weight | 338.64 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-[4-[2-(3-chloropropyl)-1,3-dioxolan-2-yl]phenyl]-5,5-dimethyl-1,3,2-dioxaborinane |
| SMILES | CC1(C)COB(c2ccc(C3(CCCCl)OCCO3)cc2)OC1 |
| InChI | InChI=1S/C17H24BClO4/c1-16(2)12-22-18(23-13-16)15-6-4-14(5-7-15)17(8-3-9-19)20-10-11-21-17/h4-7H,3,8-13H2,1-2H3 |
| InChIKey | ZWAVQAAFCBNNMN-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|