C9H6F6O3S — CID 53441790
3,5-bis(2,2,2-trifluoroacetyl)thian-4-one (PubChem CID 53441790) has the molecular formula C9H6F6O3S and a molecular weight of 308.20 g/mol. Its IUPAC name is 3,5-bis(2,2,2-trifluoroacetyl)thian-4-one.
| Compound Name | 3,5-bis(2,2,2-trifluoroacetyl)thian-4-one |
|---|---|
| PubChem CID | 53441790 |
| Molecular Formula | C9H6F6O3S |
| Molecular Weight | 308.20 g/mol |
| Exact Mass | 307.99 |
| IUPAC Name | 3,5-bis(2,2,2-trifluoroacetyl)thian-4-one |
| SMILES | O=C1C(C(=O)C(F)(F)F)CSCC1C(=O)C(F)(F)F |
| InChI | InChI=1S/C9H6F6O3S/c10-8(11,12)6(17)3-1-19-2-4(5(3)16)7(18)9(13,14)15/h3-4H,1-2H2 |
| InChIKey | NXBUDYXMUJBBCU-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|