About 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride
5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride (PubChem CID 53442212) has the molecular formula C7H6Cl4N2OZn
and a molecular weight of 341.34 g/mol. Its IUPAC name is 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride.
Molecular Properties
| Compound Name | 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride |
| PubChem CID | 53442212 |
| Molecular Formula | C7H6Cl4N2OZn |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 337.85 |
| IUPAC Name | 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride |
| SMILES | COc1ccc(Cl)cc1[N+]#N.Cl[Zn]Cl.[Cl-] |
| InChI | InChI=1S/C7H6ClN2O.3ClH.Zn/c1-11-7-3-2-5(8)4-6(7)10-9;;;;/h2-4H,1H3;3*1H;/q+1;;;;+2/p-3 |
| InChIKey | UIWVSQADDIOMNZ-UHFFFAOYSA-K |
| XLogP | 1.21 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride?
The IUPAC name of 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride (CID 53442212) is 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride.
What is the SMILES notation for 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride?
The canonical SMILES for 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride is COc1ccc(Cl)cc1[N+]#N.Cl[Zn]Cl.[Cl-].
What is the InChIKey of 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride?
The InChIKey is UIWVSQADDIOMNZ-UHFFFAOYSA-K. The full InChI is InChI=1S/C7H6ClN2O.3ClH.Zn/c1-11-7-3-2-5(8)4-6(7)10-9;;;;/h2-4H,1H3;3*1H;/q+1;;;;+2/p-3.
What are the key properties of 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride?
5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride has a molecular weight of 341.34 g/mol, XLogP of 1.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-methoxybenzenediazonium;dichlorozinc;chloride is sourced from PubChem (CID 53442212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).