About 2,3-dimethylbutane-2,3-diol;ethenylboronic acid
2,3-dimethylbutane-2,3-diol;ethenylboronic acid (PubChem CID 53442856) has the molecular formula C8H19BO4
and a molecular weight of 190.05 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;ethenylboronic acid.
Molecular Properties
| Compound Name | 2,3-dimethylbutane-2,3-diol;ethenylboronic acid |
| PubChem CID | 53442856 |
| Molecular Formula | C8H19BO4 |
| Molecular Weight | 190.05 g/mol |
| Exact Mass | 190.14 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;ethenylboronic acid |
| SMILES | C=CB(O)O.CC(C)(O)C(C)(C)O |
| InChI | InChI=1S/C6H14O2.C2H5BO2/c1-5(2,7)6(3,4)8;1-2-3(4)5/h7-8H,1-4H3;2,4-5H,1H2 |
| InChIKey | OBHCCORLMBZISY-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.05 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethylbutane-2,3-diol;ethenylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethylbutane-2,3-diol;ethenylboronic acid?
The IUPAC name of 2,3-dimethylbutane-2,3-diol;ethenylboronic acid (CID 53442856) is 2,3-dimethylbutane-2,3-diol;ethenylboronic acid.
What is the SMILES notation for 2,3-dimethylbutane-2,3-diol;ethenylboronic acid?
The canonical SMILES for 2,3-dimethylbutane-2,3-diol;ethenylboronic acid is C=CB(O)O.CC(C)(O)C(C)(C)O.
What is the InChIKey of 2,3-dimethylbutane-2,3-diol;ethenylboronic acid?
The InChIKey is OBHCCORLMBZISY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C2H5BO2/c1-5(2,7)6(3,4)8;1-2-3(4)5/h7-8H,1-4H3;2,4-5H,1H2.
What are the key properties of 2,3-dimethylbutane-2,3-diol;ethenylboronic acid?
2,3-dimethylbutane-2,3-diol;ethenylboronic acid has a molecular weight of 190.05 g/mol, XLogP of -0.29, 2 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethylbutane-2,3-diol;ethenylboronic acid is sourced from PubChem (CID 53442856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).