C8H16F6O8S2 — CID 53442946
butane-1,4-diol;bis(2,2,2-trifluoroethanesulfonic acid) (PubChem CID 53442946) has the molecular formula C8H16F6O8S2 and a molecular weight of 418.33 g/mol. Its IUPAC name is butane-1,4-diol;bis(2,2,2-trifluoroethanesulfonic acid).
| Compound Name | butane-1,4-diol;bis(2,2,2-trifluoroethanesulfonic acid) |
|---|---|
| PubChem CID | 53442946 |
| Molecular Formula | C8H16F6O8S2 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.02 |
| IUPAC Name | butane-1,4-diol;bis(2,2,2-trifluoroethanesulfonic acid) |
| SMILES | O=S(=O)(O)CC(F)(F)F.O=S(=O)(O)CC(F)(F)F.OCCCCO |
| InChI | InChI=1S/C4H10O2.2C2H3F3O3S/c5-3-1-2-4-6;2*3-2(4,5)1-9(6,7)8/h5-6H,1-4H2;2*1H2,(H,6,7,8) |
| InChIKey | IGIWNGJXNOAYKM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|