About ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid
ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid (PubChem CID 53442961) has the molecular formula C15H13F3O4S2
and a molecular weight of 378.39 g/mol. Its IUPAC name is ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid.
Molecular Properties
| Compound Name | ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid |
| PubChem CID | 53442961 |
| Molecular Formula | C15H13F3O4S2 |
| Molecular Weight | 378.39 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid |
| SMILES | CC[O-].O=S(=O)(O)c1ccc2c3ccccc3[s+](C(F)(F)F)c2c1 |
| InChI | InChI=1S/C13H7F3O3S2.C2H5O/c14-13(15,16)20-11-4-2-1-3-9(11)10-6-5-8(7-12(10)20)21(17,18)19;1-2-3/h1-7H;2H2,1H3/q;-1/p+1 |
| InChIKey | UVFXKNYFEJOKJB-UHFFFAOYSA-O |
| XLogP | 3.83 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.39 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid?
The IUPAC name of ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid (CID 53442961) is ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid.
What is the SMILES notation for ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid?
The canonical SMILES for ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid is CC[O-].O=S(=O)(O)c1ccc2c3ccccc3[s+](C(F)(F)F)c2c1.
What is the InChIKey of ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid?
The InChIKey is UVFXKNYFEJOKJB-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H7F3O3S2.C2H5O/c14-13(15,16)20-11-4-2-1-3-9(11)10-6-5-8(7-12(10)20)21(17,18)19;1-2-3/h1-7H;2H2,1H3/q;-1/p+1.
What are the key properties of ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid?
ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid has a molecular weight of 378.39 g/mol, XLogP of 3.83, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethanolate;5-(trifluoromethyl)dibenzothiophen-5-ium-3-sulfonic acid is sourced from PubChem (CID 53442961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).