C14H17ClN3O4S- — CID 53443172
N-[[4-[5-(1-chloro-2-methylpropan-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N-methylsulfamate (PubChem CID 53443172) has the molecular formula C14H17ClN3O4S- and a molecular weight of 358.83 g/mol. Its IUPAC name is N-[[4-[5-(1-chloro-2-methylpropan-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N-methylsulfamate.
| Compound Name | N-[[4-[5-(1-chloro-2-methylpropan-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N-methylsulfamate |
|---|---|
| PubChem CID | 53443172 |
| Molecular Formula | C14H17ClN3O4S- |
| Molecular Weight | 358.83 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-[[4-[5-(1-chloro-2-methylpropan-2-yl)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-N-methylsulfamate |
| SMILES | CN(Cc1ccc(-c2noc(C(C)(C)CCl)n2)cc1)S(=O)(=O)[O-] |
| InChI | InChI=1S/C14H18ClN3O4S/c1-14(2,9-15)13-16-12(17-22-13)11-6-4-10(5-7-11)8-18(3)23(19,20)21/h4-7H,8-9H2,1-3H3,(H,19,20,21)/p-1 |
| InChIKey | RSCCRHJKFHOEQB-UHFFFAOYSA-M |
| XLogP | 2.14 |
| TPSA | 99.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.83 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|