About 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine
4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine (PubChem CID 53443506) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine |
| PubChem CID | 53443506 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine |
| SMILES | COc1ccnc2c1c(C)nn2C |
| InChI | InChI=1S/C9H11N3O/c1-6-8-7(13-3)4-5-10-9(8)12(2)11-6/h4-5H,1-3H3 |
| InChIKey | GSPDLVNTOZMGQD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine?
The IUPAC name of 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine (CID 53443506) is 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine.
What is the SMILES notation for 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine?
The canonical SMILES for 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine is COc1ccnc2c1c(C)nn2C.
What is the InChIKey of 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine?
The InChIKey is GSPDLVNTOZMGQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3O/c1-6-8-7(13-3)4-5-10-9(8)12(2)11-6/h4-5H,1-3H3.
What are the key properties of 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine?
4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine has a molecular weight of 177.21 g/mol, XLogP of 1.29, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-1,3-dimethylpyrazolo[3,4-b]pyridine is sourced from PubChem (CID 53443506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).