About 3-methylsulfanylnonanal
3-methylsulfanylnonanal (PubChem CID 534442) has the molecular formula C10H20OS
and a molecular weight of 188.34 g/mol. Its IUPAC name is 3-methylsulfanylnonanal.
Molecular Properties
| Compound Name | 3-methylsulfanylnonanal |
| PubChem CID | 534442 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 3-methylsulfanylnonanal |
| SMILES | CCCCCCC(CC=O)SC |
| InChI | InChI=1S/C10H20OS/c1-3-4-5-6-7-10(12-2)8-9-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | JSYSQMMAZDDRLW-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfanylnonanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanylnonanal?
The IUPAC name of 3-methylsulfanylnonanal (CID 534442) is 3-methylsulfanylnonanal.
What is the SMILES notation for 3-methylsulfanylnonanal?
The canonical SMILES for 3-methylsulfanylnonanal is CCCCCCC(CC=O)SC.
What is the InChIKey of 3-methylsulfanylnonanal?
The InChIKey is JSYSQMMAZDDRLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20OS/c1-3-4-5-6-7-10(12-2)8-9-11/h9-10H,3-8H2,1-2H3.
What are the key properties of 3-methylsulfanylnonanal?
3-methylsulfanylnonanal has a molecular weight of 188.34 g/mol, XLogP of 3.28, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanylnonanal is sourced from PubChem (CID 534442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).