About (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride
(4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride (PubChem CID 53444355) has the molecular formula C10H14ClNO4
and a molecular weight of 247.68 g/mol. Its IUPAC name is (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride.
Molecular Properties
| Compound Name | (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride |
| PubChem CID | 53444355 |
| Molecular Formula | C10H14ClNO4 |
| Molecular Weight | 247.68 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride |
| SMILES | COc1cc(CN)c(OC)c2c1OCO2.Cl |
| InChI | InChI=1S/C10H13NO4.ClH/c1-12-7-3-6(4-11)8(13-2)10-9(7)14-5-15-10;/h3H,4-5,11H2,1-2H3;1H |
| InChIKey | ZZJXLAPXGVSQFR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.68 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride?
The IUPAC name of (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride (CID 53444355) is (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride.
What is the SMILES notation for (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride?
The canonical SMILES for (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride is COc1cc(CN)c(OC)c2c1OCO2.Cl.
What is the InChIKey of (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride?
The InChIKey is ZZJXLAPXGVSQFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO4.ClH/c1-12-7-3-6(4-11)8(13-2)10-9(7)14-5-15-10;/h3H,4-5,11H2,1-2H3;1H.
What are the key properties of (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride?
(4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride has a molecular weight of 247.68 g/mol, XLogP of 1.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4,7-dimethoxy-1,3-benzodioxol-5-yl)methanamine;hydrochloride is sourced from PubChem (CID 53444355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).