C11H14ClN5O2 — CID 53444484
3-[5-[(dimethylamino)methyl]tetrazol-1-yl]benzoic acid;hydrochloride (PubChem CID 53444484) has the molecular formula C11H14ClN5O2 and a molecular weight of 283.72 g/mol. Its IUPAC name is 3-[5-[(dimethylamino)methyl]tetrazol-1-yl]benzoic acid;hydrochloride.
| Compound Name | 3-[5-[(dimethylamino)methyl]tetrazol-1-yl]benzoic acid;hydrochloride |
|---|---|
| PubChem CID | 53444484 |
| Molecular Formula | C11H14ClN5O2 |
| Molecular Weight | 283.72 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-[5-[(dimethylamino)methyl]tetrazol-1-yl]benzoic acid;hydrochloride |
| SMILES | CN(C)Cc1nnnn1-c1cccc(C(=O)O)c1.Cl |
| InChI | InChI=1S/C11H13N5O2.ClH/c1-15(2)7-10-12-13-14-16(10)9-5-3-4-8(6-9)11(17)18;/h3-6H,7H2,1-2H3,(H,17,18);1H |
| InChIKey | FWZBGLBVHDYMPE-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 84.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.72 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |