About 2-ethyl-3-pentyloxirane
2-ethyl-3-pentyloxirane (PubChem CID 534445) has the molecular formula C9H18O
and a molecular weight of 142.24 g/mol. Its IUPAC name is 2-ethyl-3-pentyloxirane.
Molecular Properties
| Compound Name | 2-ethyl-3-pentyloxirane |
| PubChem CID | 534445 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2-ethyl-3-pentyloxirane |
| SMILES | CCCCCC1OC1CC |
| InChI | InChI=1S/C9H18O/c1-3-5-6-7-9-8(4-2)10-9/h8-9H,3-7H2,1-2H3 |
| InChIKey | BRBFKTQUGYOOEX-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-3-pentyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-pentyloxirane?
The IUPAC name of 2-ethyl-3-pentyloxirane (CID 534445) is 2-ethyl-3-pentyloxirane.
What is the SMILES notation for 2-ethyl-3-pentyloxirane?
The canonical SMILES for 2-ethyl-3-pentyloxirane is CCCCCC1OC1CC.
What is the InChIKey of 2-ethyl-3-pentyloxirane?
The InChIKey is BRBFKTQUGYOOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O/c1-3-5-6-7-9-8(4-2)10-9/h8-9H,3-7H2,1-2H3.
What are the key properties of 2-ethyl-3-pentyloxirane?
2-ethyl-3-pentyloxirane has a molecular weight of 142.24 g/mol, XLogP of 2.74, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-pentyloxirane is sourced from PubChem (CID 534445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).