C22H20N4O2S — CID 5344545
2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(E)-1-(furan-2-yl)ethylideneamino]acetamide (PubChem CID 5344545) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(E)-1-(furan-2-yl)ethylideneamino]acetamide.
| Compound Name | 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(E)-1-(furan-2-yl)ethylideneamino]acetamide |
|---|---|
| PubChem CID | 5344545 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(1-benzylbenzimidazol-2-yl)sulfanyl-N-[(E)-1-(furan-2-yl)ethylideneamino]acetamide |
| SMILES | C/C(=N\NC(=O)CSc1nc2ccccc2n1Cc1ccccc1)c1ccco1 |
| InChI | InChI=1S/C22H20N4O2S/c1-16(20-12-7-13-28-20)24-25-21(27)15-29-22-23-18-10-5-6-11-19(18)26(22)14-17-8-3-2-4-9-17/h2-13H,14-15H2,1H3,(H,25,27)/b24-16+ |
| InChIKey | JWPQWDZJGIGVGY-LFVJCYFKSA-N |
| XLogP | 4.31 |
| TPSA | 72.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|