About 1H-indazole
1H-indazole (PubChem CID 53445851) has the molecular formula C14H12N4
and a molecular weight of 236.28 g/mol. Its IUPAC name is 1H-indazole.
Molecular Properties
| Compound Name | 1H-indazole |
| PubChem CID | 53445851 |
| Molecular Formula | C14H12N4 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 1H-indazole |
| SMILES | c1ccc2[nH]ncc2c1.c1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/2C7H6N2/c2*1-2-4-7-6(3-1)5-8-9-7/h2*1-5H,(H,8,9) |
| InChIKey | BNIFVTPIXGUZCU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazole?
The IUPAC name of 1H-indazole (CID 53445851) is 1H-indazole.
What is the SMILES notation for 1H-indazole?
The canonical SMILES for 1H-indazole is c1ccc2[nH]ncc2c1.c1ccc2[nH]ncc2c1.
What is the InChIKey of 1H-indazole?
The InChIKey is BNIFVTPIXGUZCU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H6N2/c2*1-2-4-7-6(3-1)5-8-9-7/h2*1-5H,(H,8,9).
What are the key properties of 1H-indazole?
1H-indazole has a molecular weight of 236.28 g/mol, XLogP of 3.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazole is sourced from PubChem (CID 53445851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).