About 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate
4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate (PubChem CID 53446572) has the molecular formula C39H62O12
and a molecular weight of 722.91 g/mol. Its IUPAC name is 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate.
Molecular Properties
| Compound Name | 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate |
| PubChem CID | 53446572 |
| Molecular Formula | C39H62O12 |
| Molecular Weight | 722.91 g/mol |
| Exact Mass | 722.42 |
| IUPAC Name | 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate |
| SMILES | CCCCC(CC)COC(=O)C=CC(=O)OCC(COC(=O)C=CC(=O)OCC(CC)CCCC)OC(=O)C=CC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C39H62O12/c1-7-13-16-30(10-4)25-46-34(40)19-21-37(43)49-28-33(51-39(45)24-23-36(42)48-27-32(12-6)18-15-9-3)29-50-38(44)22-20-35(41)47-26-31(11-5)17-14-8-2/h19-24,30-33H,7-18,25-29H2,1-6H3 |
| InChIKey | KIYBJPDCYKHDEI-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 51 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 722.91 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate?
The IUPAC name of 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate (CID 53446572) is 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate.
What is the SMILES notation for 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate?
The canonical SMILES for 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate is CCCCC(CC)COC(=O)C=CC(=O)OCC(COC(=O)C=CC(=O)OCC(CC)CCCC)OC(=O)C=CC(=O)OCC(CC)CCCC.
What is the InChIKey of 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate?
The InChIKey is KIYBJPDCYKHDEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C39H62O12/c1-7-13-16-30(10-4)25-46-34(40)19-21-37(43)49-28-33(51-39(45)24-23-36(42)48-27-32(12-6)18-15-9-3)29-50-38(44)22-20-35(41)47-26-31(11-5)17-14-8-2/h19-24,30-33H,7-18,25-29H2,1-6H3.
What are the key properties of 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate?
4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate has a molecular weight of 722.91 g/mol, XLogP of 6.93, 29 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-[2,3-bis[[4-(2-ethylhexoxy)-4-oxobut-2-enoyl]oxy]propyl] 1-O-(2-ethylhexyl) but-2-enedioate is sourced from PubChem (CID 53446572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).