About N-bromo-2-fluoroaniline
N-bromo-2-fluoroaniline (PubChem CID 53446576) has the molecular formula C6H5BrFN
and a molecular weight of 190.02 g/mol. Its IUPAC name is N-bromo-2-fluoroaniline.
Molecular Properties
| Compound Name | N-bromo-2-fluoroaniline |
| PubChem CID | 53446576 |
| Molecular Formula | C6H5BrFN |
| Molecular Weight | 190.02 g/mol |
| Exact Mass | 188.96 |
| IUPAC Name | N-bromo-2-fluoroaniline |
| SMILES | Fc1ccccc1NBr |
| InChI | InChI=1S/C6H5BrFN/c7-9-6-4-2-1-3-5(6)8/h1-4,9H |
| InChIKey | PFZOORYCYRPFLK-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.02 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-bromo-2-fluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-bromo-2-fluoroaniline?
The IUPAC name of N-bromo-2-fluoroaniline (CID 53446576) is N-bromo-2-fluoroaniline.
What is the SMILES notation for N-bromo-2-fluoroaniline?
The canonical SMILES for N-bromo-2-fluoroaniline is Fc1ccccc1NBr.
What is the InChIKey of N-bromo-2-fluoroaniline?
The InChIKey is PFZOORYCYRPFLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrFN/c7-9-6-4-2-1-3-5(6)8/h1-4,9H.
What are the key properties of N-bromo-2-fluoroaniline?
N-bromo-2-fluoroaniline has a molecular weight of 190.02 g/mol, XLogP of 2.55, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-bromo-2-fluoroaniline is sourced from PubChem (CID 53446576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).