1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride

C10H21Cl2N — CID 53446675

IUPAC1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride
SMILESCC1CCCC(C)[NH+]1CCCCl.[Cl-]
InChIInChI=1S/C10H20ClN.ClH/c1-9-5-3-6-10(2)12(9)8-4-7-11;/h9-10H,3-8H2,1-2H3;1H
InChIKeyCEEKMXMGOHQJAL-UHFFFAOYSA-N
MW226.19 g/mol
LogP-1.53
Rot. Bonds3

About 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride

1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride (PubChem CID 53446675) has the molecular formula C10H21Cl2N and a molecular weight of 226.19 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride.

Molecular Properties

Compound Name1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride
PubChem CID53446675
Molecular FormulaC10H21Cl2N
Molecular Weight226.19 g/mol
Exact Mass225.11
IUPAC Name1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride
SMILESCC1CCCC(C)[NH+]1CCCCl.[Cl-]
InChIInChI=1S/C10H20ClN.ClH/c1-9-5-3-6-10(2)12(9)8-4-7-11;/h9-10H,3-8H2,1-2H3;1H
InChIKeyCEEKMXMGOHQJAL-UHFFFAOYSA-N
XLogP-1.53
TPSA4.44 Ų
H-Bond Donors1
H-Bond Acceptors
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.19
LogP ≤ 5-1.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 100

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride?
The IUPAC name of 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride (CID 53446675) is 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride.
What is the SMILES notation for 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride?
The canonical SMILES for 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride is CC1CCCC(C)[NH+]1CCCCl.[Cl-].
What is the InChIKey of 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride?
The InChIKey is CEEKMXMGOHQJAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClN.ClH/c1-9-5-3-6-10(2)12(9)8-4-7-11;/h9-10H,3-8H2,1-2H3;1H.
What are the key properties of 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride?
1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride has a molecular weight of 226.19 g/mol, XLogP of -1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride is sourced from PubChem (CID 53446675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).