About 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride
1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride (PubChem CID 53446675) has the molecular formula C10H21Cl2N
and a molecular weight of 226.19 g/mol. Its IUPAC name is 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride.
Molecular Properties
| Compound Name | 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride |
| PubChem CID | 53446675 |
| Molecular Formula | C10H21Cl2N |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride |
| SMILES | CC1CCCC(C)[NH+]1CCCCl.[Cl-] |
| InChI | InChI=1S/C10H20ClN.ClH/c1-9-5-3-6-10(2)12(9)8-4-7-11;/h9-10H,3-8H2,1-2H3;1H |
| InChIKey | CEEKMXMGOHQJAL-UHFFFAOYSA-N |
| XLogP | -1.53 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride?
The IUPAC name of 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride (CID 53446675) is 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride.
What is the SMILES notation for 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride?
The canonical SMILES for 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride is CC1CCCC(C)[NH+]1CCCCl.[Cl-].
What is the InChIKey of 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride?
The InChIKey is CEEKMXMGOHQJAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20ClN.ClH/c1-9-5-3-6-10(2)12(9)8-4-7-11;/h9-10H,3-8H2,1-2H3;1H.
What are the key properties of 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride?
1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride has a molecular weight of 226.19 g/mol, XLogP of -1.53, 3 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-chloropropyl)-2,6-dimethylpiperidin-1-ium chloride is sourced from PubChem (CID 53446675), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).