About (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol
(3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol (PubChem CID 53446888) has the molecular formula C19H15BrF2O
and a molecular weight of 377.23 g/mol. Its IUPAC name is (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol.
Molecular Properties
| Compound Name | (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol |
| PubChem CID | 53446888 |
| Molecular Formula | C19H15BrF2O |
| Molecular Weight | 377.23 g/mol |
| Exact Mass | 376.03 |
| IUPAC Name | (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol |
| SMILES | OC(C1=CCC(F)(F)C=C1)(c1ccccc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C19H15BrF2O/c20-17-8-4-7-16(13-17)19(23,14-5-2-1-3-6-14)15-9-11-18(21,22)12-10-15/h1-11,13,23H,12H2 |
| InChIKey | UIHYXHPMVOSEPV-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 377.23 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol?
The IUPAC name of (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol (CID 53446888) is (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol.
What is the SMILES notation for (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol?
The canonical SMILES for (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol is OC(C1=CCC(F)(F)C=C1)(c1ccccc1)c1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol?
The InChIKey is UIHYXHPMVOSEPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15BrF2O/c20-17-8-4-7-16(13-17)19(23,14-5-2-1-3-6-14)15-9-11-18(21,22)12-10-15/h1-11,13,23H,12H2.
What are the key properties of (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol?
(3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol has a molecular weight of 377.23 g/mol, XLogP of 5.21, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)-(4,4-difluorocyclohexa-1,5-dien-1-yl)-phenylmethanol is sourced from PubChem (CID 53446888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).