1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride

C6H11ClN2 — CID 53447165

IUPAC1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride
SMILESC=C[NH+]1C=CN(C)C1.[Cl-]
InChIInChI=1S/C6H10N2.ClH/c1-3-8-5-4-7(2)6-8;/h3-5H,1,6H2,2H3;1H
InChIKeyQARDSQYLYGISQN-UHFFFAOYSA-N
MW146.62 g/mol
LogP-3.61
Rot. Bonds1

About 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride

1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride (PubChem CID 53447165) has the molecular formula C6H11ClN2 and a molecular weight of 146.62 g/mol. Its IUPAC name is 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride.

Molecular Properties

Compound Name1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride
PubChem CID53447165
Molecular FormulaC6H11ClN2
Molecular Weight146.62 g/mol
Exact Mass146.06
IUPAC Name1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride
SMILESC=C[NH+]1C=CN(C)C1.[Cl-]
InChIInChI=1S/C6H10N2.ClH/c1-3-8-5-4-7(2)6-8;/h3-5H,1,6H2,2H3;1H
InChIKeyQARDSQYLYGISQN-UHFFFAOYSA-N
XLogP-3.61
TPSA7.68 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.62
LogP ≤ 5-3.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride?
The IUPAC name of 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride (CID 53447165) is 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride.
What is the SMILES notation for 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride?
The canonical SMILES for 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride is C=C[NH+]1C=CN(C)C1.[Cl-].
What is the InChIKey of 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride?
The InChIKey is QARDSQYLYGISQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2.ClH/c1-3-8-5-4-7(2)6-8;/h3-5H,1,6H2,2H3;1H.
What are the key properties of 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride?
1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride has a molecular weight of 146.62 g/mol, XLogP of -3.61, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenyl-3-methyl-1,2-dihydroimidazol-1-ium chloride is sourced from PubChem (CID 53447165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).