About but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol
but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol (PubChem CID 53447267) has the molecular formula C24H31NO5
and a molecular weight of 413.51 g/mol. Its IUPAC name is but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol.
Molecular Properties
| Compound Name | but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol |
| PubChem CID | 53447267 |
| Molecular Formula | C24H31NO5 |
| Molecular Weight | 413.51 g/mol |
| Exact Mass | 413.22 |
| IUPAC Name | but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol |
| SMILES | CC(C)CNCCCC(O)(c1ccccc1)c1ccccc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H27NO.C4H4O4/c1-17(2)16-21-15-9-14-20(22,18-10-5-3-6-11-18)19-12-7-4-8-13-19;5-3(6)1-2-4(7)8/h3-8,10-13,17,21-22H,9,14-16H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | SUAYYSYTGBQBMK-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.51 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol?
The IUPAC name of but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol (CID 53447267) is but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol.
What is the SMILES notation for but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol?
The canonical SMILES for but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol is CC(C)CNCCCC(O)(c1ccccc1)c1ccccc1.O=C(O)C=CC(=O)O.
What is the InChIKey of but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol?
The InChIKey is SUAYYSYTGBQBMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27NO.C4H4O4/c1-17(2)16-21-15-9-14-20(22,18-10-5-3-6-11-18)19-12-7-4-8-13-19;5-3(6)1-2-4(7)8/h3-8,10-13,17,21-22H,9,14-16H2,1-2H3;1-2H,(H,5,6)(H,7,8).
What are the key properties of but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol?
but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol has a molecular weight of 413.51 g/mol, XLogP of 3.66, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enedioic acid;4-(2-methylpropylamino)-1,1-diphenylbutan-1-ol is sourced from PubChem (CID 53447267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).