About 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride
1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride (PubChem CID 5344776) has the molecular formula C15H14ClF2N5
and a molecular weight of 337.76 g/mol. Its IUPAC name is 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride.
Molecular Properties
| Compound Name | 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride |
| PubChem CID | 5344776 |
| Molecular Formula | C15H14ClF2N5 |
| Molecular Weight | 337.76 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride |
| SMILES | Cl.N/C(=N\N=C/c1ccc(F)cc1)N/N=C\c1ccc(F)cc1 |
| InChI | InChI=1S/C15H13F2N5.ClH/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12;/h1-10H,(H3,18,21,22);1H/b19-9-,20-10-; |
| InChIKey | JRXXIWPSMZWCOW-IVQQKVMJSA-N |
| XLogP | 2.66 |
| TPSA | 75.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.76 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride?
The IUPAC name of 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride (CID 5344776) is 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride.
What is the SMILES notation for 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride?
The canonical SMILES for 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride is Cl.N/C(=N\N=C/c1ccc(F)cc1)N/N=C\c1ccc(F)cc1.
What is the InChIKey of 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride?
The InChIKey is JRXXIWPSMZWCOW-IVQQKVMJSA-N. The full InChI is InChI=1S/C15H13F2N5.ClH/c16-13-5-1-11(2-6-13)9-19-21-15(18)22-20-10-12-3-7-14(17)8-4-12;/h1-10H,(H3,18,21,22);1H/b19-9-,20-10-;.
What are the key properties of 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride?
1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride has a molecular weight of 337.76 g/mol, XLogP of 2.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis[(Z)-(4-fluorophenyl)methylideneamino]guanidine;hydrochloride is sourced from PubChem (CID 5344776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).