C25H24FN3O — CID 53447831
5-(4-fluorophenyl)-3,4-bis(4-methylphenyl)-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one (PubChem CID 53447831) has the molecular formula C25H24FN3O and a molecular weight of 401.49 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3,4-bis(4-methylphenyl)-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one.
| Compound Name | 5-(4-fluorophenyl)-3,4-bis(4-methylphenyl)-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one |
|---|---|
| PubChem CID | 53447831 |
| Molecular Formula | C25H24FN3O |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 5-(4-fluorophenyl)-3,4-bis(4-methylphenyl)-1,2,3,3a,4,6a-hexahydropyrrolo[3,4-c]pyrazol-6-one |
| SMILES | Cc1ccc(C2NNC3C(=O)N(c4ccc(F)cc4)C(c4ccc(C)cc4)C32)cc1 |
| InChI | InChI=1S/C25H24FN3O/c1-15-3-7-17(8-4-15)22-21-23(28-27-22)25(30)29(20-13-11-19(26)12-14-20)24(21)18-9-5-16(2)6-10-18/h3-14,21-24,27-28H,1-2H3 |
| InChIKey | RLNUEVNNPDRXTM-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |