About [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate
[(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate (PubChem CID 5344811) has the molecular formula C13H10FN3O2
and a molecular weight of 259.24 g/mol. Its IUPAC name is [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate.
Molecular Properties
| Compound Name | [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate |
| PubChem CID | 5344811 |
| Molecular Formula | C13H10FN3O2 |
| Molecular Weight | 259.24 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate |
| SMILES | N/C(=N\OC(=O)c1ccc(F)cc1)c1ccncc1 |
| InChI | InChI=1S/C13H10FN3O2/c14-11-3-1-10(2-4-11)13(18)19-17-12(15)9-5-7-16-8-6-9/h1-8H,(H2,15,17) |
| InChIKey | BAHXAZNWBMWSQK-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate?
The IUPAC name of [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate (CID 5344811) is [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate.
What is the SMILES notation for [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate?
The canonical SMILES for [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate is N/C(=N\OC(=O)c1ccc(F)cc1)c1ccncc1.
What is the InChIKey of [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate?
The InChIKey is BAHXAZNWBMWSQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10FN3O2/c14-11-3-1-10(2-4-11)13(18)19-17-12(15)9-5-7-16-8-6-9/h1-8H,(H2,15,17).
What are the key properties of [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate?
[(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate has a molecular weight of 259.24 g/mol, XLogP of 1.70, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-[amino(pyridin-4-yl)methylidene]amino] 4-fluorobenzoate is sourced from PubChem (CID 5344811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).