C14H18NO4- — CID 53448611
6-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)hexanoate (PubChem CID 53448611) has the molecular formula C14H18NO4- and a molecular weight of 264.30 g/mol. Its IUPAC name is 6-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)hexanoate.
| Compound Name | 6-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)hexanoate |
|---|---|
| PubChem CID | 53448611 |
| Molecular Formula | C14H18NO4- |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 6-(1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl)hexanoate |
| SMILES | O=C([O-])CCCCCN1C(=O)C2CC=CCC2C1=O |
| InChI | InChI=1S/C14H19NO4/c16-12(17)8-2-1-5-9-15-13(18)10-6-3-4-7-11(10)14(15)19/h3-4,10-11H,1-2,5-9H2,(H,16,17)/p-1 |
| InChIKey | IACNEMHLZLHRPW-UHFFFAOYSA-M |
| XLogP | 0.25 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|