About N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide
N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide (PubChem CID 5344910) has the molecular formula C26H25BrN2OS
and a molecular weight of 493.47 g/mol. Its IUPAC name is N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide.
Molecular Properties
| Compound Name | N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide |
| PubChem CID | 5344910 |
| Molecular Formula | C26H25BrN2OS |
| Molecular Weight | 493.47 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide |
| SMILES | CCOc1ccc(N/C(C)=C/c2scc(-c3ccccc3)[n+]2-c2ccccc2)cc1.[Br-] |
| InChI | InChI=1S/C26H24N2OS.BrH/c1-3-29-24-16-14-22(15-17-24)27-20(2)18-26-28(23-12-8-5-9-13-23)25(19-30-26)21-10-6-4-7-11-21;/h4-19H,3H2,1-2H3;1H |
| InChIKey | ZHKSCPQACJHDFA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 25.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.47 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide?
The IUPAC name of N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide (CID 5344910) is N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide.
What is the SMILES notation for N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide?
The canonical SMILES for N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide is CCOc1ccc(N/C(C)=C/c2scc(-c3ccccc3)[n+]2-c2ccccc2)cc1.[Br-].
What is the InChIKey of N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide?
The InChIKey is ZHKSCPQACJHDFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H24N2OS.BrH/c1-3-29-24-16-14-22(15-17-24)27-20(2)18-26-28(23-12-8-5-9-13-23)25(19-30-26)21-10-6-4-7-11-21;/h4-19H,3H2,1-2H3;1H.
What are the key properties of N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide?
N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide has a molecular weight of 493.47 g/mol, XLogP of 3.57, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(E)-1-(3,4-diphenyl-1,3-thiazol-3-ium-2-yl)prop-1-en-2-yl]-4-ethoxyaniline bromide is sourced from PubChem (CID 5344910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).