C18H20FN5O2 — CID 53449148
6'-amino-3'-butyl-5-fluoro-2-oxospiro[1H-indole-3,4'-2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole]-5'-carbonitrile (PubChem CID 53449148) has the molecular formula C18H20FN5O2 and a molecular weight of 357.39 g/mol. Its IUPAC name is 6'-amino-3'-butyl-5-fluoro-2-oxospiro[1H-indole-3,4'-2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole]-5'-carbonitrile.
| Compound Name | 6'-amino-3'-butyl-5-fluoro-2-oxospiro[1H-indole-3,4'-2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole]-5'-carbonitrile |
|---|---|
| PubChem CID | 53449148 |
| Molecular Formula | C18H20FN5O2 |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.16 |
| IUPAC Name | 6'-amino-3'-butyl-5-fluoro-2-oxospiro[1H-indole-3,4'-2,3,3a,7a-tetrahydro-1H-pyrano[2,3-c]pyrazole]-5'-carbonitrile |
| SMILES | CCCCC1NNC2OC(N)=C(C#N)C3(C(=O)Nc4ccc(F)cc43)C12 |
| InChI | InChI=1S/C18H20FN5O2/c1-2-3-4-13-14-16(24-23-13)26-15(21)11(8-20)18(14)10-7-9(19)5-6-12(10)22-17(18)25/h5-7,13-14,16,23-24H,2-4,21H2,1H3,(H,22,25) |
| InChIKey | FZJXGDGSDWJJCS-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |